Difference between revisions of "Tiso gene 17238"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] == * smiles: ** CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...")
(Created page with "Category:Gene == Gene Tiso_gene_17238 == * right end position: ** 1309 * transcription direction: ** NEGATIVE * left end position: ** 22 * centisome position: ** 0.5736636...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] ==
+
== Gene Tiso_gene_17238 ==
−
* smiles:
+
* right end position:
−
** CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1309
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 3-trans-decenoyl-CoA
+
** 22
−
* molecular weight:
+
* centisome position:
−
** 915.738    
+
** 0.57366365    
 
* Synonym(s):
 
* Synonym(s):
−
** 3E-decenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
−
* [[RXN-14803]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6352]]
 +
* [[PWY-6351]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1309}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657610 90657610]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=22}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84793 84793]
+
{{#set: centisome position=0.57366365   }}
−
{{#set: smiles=CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=1-PHOSPHATIDYLINOSITOL-KINASE-RXN}}
−
{{#set: inchi key=InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J}}
+
{{#set: pathway associated=PWY-6352|PWY-6351}}
−
{{#set: common name=3-trans-decenoyl-CoA}}
+
−
{{#set: molecular weight=915.738   }}
+
−
{{#set: common name=3E-decenoyl-CoA}}
+
−
{{#set: produced by=RXN-14803}}
+

Latest revision as of 19:19, 21 March 2018

Gene Tiso_gene_17238

  • right end position:
    • 1309
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 22
  • centisome position:
    • 0.57366365
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17238&oldid=40837"