Difference between revisions of "Tiso gene 9846"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == * smiles: ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C...")
(Created page with "Category:Gene == Gene Tiso_gene_9846 == * Synonym(s): == Reactions associated == * Reaction: PROTEIN-KINASE-RXN ** Source: orthology-esiliculosus == Pathways asso...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] ==
+
== Gene Tiso_gene_9846 ==
* smiles:
+
** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
+
* common name:
+
** 7-dehydrocholesterol
+
* inchi key:
+
** InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
+
* molecular weight:
+
** 384.644   
+
 
* Synonym(s):
 
* Synonym(s):
** cholesta-5,7-dien-3 β-ol
 
** cholesta-5,7-dienol
 
** 7-dehydro-cholesterol
 
** cholesta-5,7-dien-3β-ol
 
** provitamin D3
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN66-323]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
* [[1.14.21.6-RXN]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* CAS : 434-16-2
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439423 439423]
+
* HMDB : HMDB00032
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17759 17759]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01164 C01164]
+
{{#set: smiles=CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))}}
+
{{#set: common name=7-dehydrocholesterol}}
+
{{#set: inchi key=InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N}}
+
{{#set: molecular weight=384.644    }}
+
{{#set: common name=cholesta-5,7-dien-3 β-ol|cholesta-5,7-dienol|7-dehydro-cholesterol|cholesta-5,7-dien-3β-ol|provitamin D3}}
+
{{#set: consumed by=RXN66-323}}
+
{{#set: produced by=1.14.21.6-RXN}}
+

Latest revision as of 19:19, 21 March 2018

Gene Tiso_gene_9846

  • Synonym(s):

Reactions associated

Pathways associated

External links