Difference between revisions of "CPD-19489"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == * smiles: ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-isop...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-isopropyl-8-(methylthio)-2-oxooctanoate |
| + | * inchi key: | ||
| + | ** InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 246.278 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-18205]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-18204]] | ||
== External links == | == External links == | ||
| − | {{#set: smiles= | + | {{#set: smiles=CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} |
| − | {{#set: | + | {{#set: common name=3-isopropyl-8-(methylthio)-2-oxooctanoate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=246.278 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-18205}} |
| − | {{#set: | + | {{#set: reversible reaction associated=RXN-18204}} |
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite CPD-19489
- smiles:
- CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-isopropyl-8-(methylthio)-2-oxooctanoate
- inchi key:
- InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L
- molecular weight:
- 246.278
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
