Difference between revisions of "CPD-19489"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5871 PWY-5871] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == * smiles: ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-isop...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] |
* common name: | * common name: | ||
| − | ** | + | ** 3-isopropyl-8-(methylthio)-2-oxooctanoate |
| + | * inchi key: | ||
| + | ** InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L | ||
| + | * molecular weight: | ||
| + | ** 246.278 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-18205]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-18204]] | |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} |
| − | {{#set: common name= | + | {{#set: common name=3-isopropyl-8-(methylthio)-2-oxooctanoate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L}} |
| − | {{#set: | + | {{#set: molecular weight=246.278 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-18205}} |
| − | {{#set: | + | {{#set: reversible reaction associated=RXN-18204}} |
Latest revision as of 20:19, 21 March 2018
Contents
Metabolite CPD-19489
- smiles:
- CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-isopropyl-8-(methylthio)-2-oxooctanoate
- inchi key:
- InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L
- molecular weight:
- 246.278
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
