Difference between revisions of "RXN1G-1053"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1053 RXN1G-1053] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta19-3-oxo-C38:1-[...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1053 RXN1G-1053] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** glutaryl-CoA
+
** cis-delta19-3-oxo-C38:1-[acyl-carrier protein] reductase
−
* inchi key:
+
* ec number:
−
** InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I
+
** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9]
−
* molecular weight:
+
−
** 876.595   
+
 
* Synonym(s):
 
* Synonym(s):
−
** glutaryl-coenzyme A
 
−
** 4-carboxybutanoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[cis-delta19-3-oxo-C38-ACPs]][c] '''=>''' 1 [[cis-delta19-3-hydroxyC38-ACPs]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-8032]]
+
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a cis-delta19-3-oxo-C38:1-[acp][c] '''=>''' 1 a cis-delta19-3-hydroxyC38:1-[acp][c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13083]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00527 C00527]
+
{{#set: common name=cis-delta19-3-oxo-C38:1-[acyl-carrier protein] reductase}}
−
* HMDB : HMDB01339
+
{{#set: ec number=EC-1.1.1.M9}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_13083}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57378 57378]
+
{{#set: in pathway=PWYG-321}}
−
* METABOLIGHTS : MTBLC57378
+
{{#set: reconstruction category=orthology|annotation}}
−
* PUBCHEM:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266604 45266604]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: common name=glutaryl-CoA}}
+
−
{{#set: inchi key=InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I}}
+
−
{{#set: molecular weight=876.595    }}
+
−
{{#set: common name=glutaryl-coenzyme A|4-carboxybutanoyl-CoA}}
+
−
{{#set: produced by=2-KETO-ADIPATE-DEHYDROG-RXN}}
+
−
{{#set: reversible reaction associated=RXN-8032}}
+

Latest revision as of 19:19, 21 March 2018

Reaction RXN1G-1053

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis-delta19-3-oxo-C38:1-[acyl-carrier protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis-delta19-3-oxo-C38:1-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-1053&oldid=40868"