Difference between revisions of "Tiso gene 15329"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_15329 == * right end position: ** 3544 * transcription direction: ** POSITIVE * left end position: ** 530 * centisome position: ** 10.40439...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15329 == |
− | * | + | * right end position: |
− | ** | + | ** 3544 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 530 |
− | * | + | * centisome position: |
− | ** | + | ** 10.404398 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.7.11.24-RXN]] |
− | + | ** Source: [[annotation-experimental_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=3544}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: left end position=530}} |
− | {{#set: | + | {{#set: centisome position=10.404398 }} |
− | {{#set: | + | {{#set: reaction associated=2.7.11.24-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:19, 21 March 2018
Gene Tiso_gene_15329
- right end position:
- 3544
- transcription direction:
- POSITIVE
- left end position:
- 530
- centisome position:
- 10.404398
- Synonym(s):
Reactions associated
- Reaction: 2.7.11.24-RXN
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation