Difference between revisions of "CPD-18352"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-] * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18352 CPD-18352] == * smiles: ** CCCCCCC=CCCCCCCCCCC(OC(COC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18352 CPD-18352] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCC=CCCCCCCCCCC(OC(COC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O)[O-])=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 1-palmitoyl-2-cis-vaccenoyl phosphatidate |
| + | * inchi key: | ||
| + | ** InChIKey=YDFKTEAAIYLUQP-WNHJEKBPSA-L | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 672.921 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 16:0-18:1-PA | ||
| + | ** 1-palmitoyl-2-(11Z-octadecenoyl)-sn-glycerol-3-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17010]] |
| + | * [[RXN-17014]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514933 102514933] |
| − | + | {{#set: smiles=CCCCCCC=CCCCCCCCCCC(OC(COC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O)[O-])=O}} | |
| − | + | {{#set: common name=1-palmitoyl-2-cis-vaccenoyl phosphatidate}} | |
| − | + | {{#set: inchi key=InChIKey=YDFKTEAAIYLUQP-WNHJEKBPSA-L}} | |
| − | + | {{#set: molecular weight=672.921 }} | |
| − | + | {{#set: common name=16:0-18:1-PA|1-palmitoyl-2-(11Z-octadecenoyl)-sn-glycerol-3-phosphate}} | |
| − | + | {{#set: produced by=RXN-17010|RXN-17014}} | |
| − | {{#set: smiles= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | {{#set: produced by=RXN- | + | |
| − | + | ||
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite CPD-18352
- smiles:
- CCCCCCC=CCCCCCCCCCC(OC(COC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O)[O-])=O
- common name:
- 1-palmitoyl-2-cis-vaccenoyl phosphatidate
- inchi key:
- InChIKey=YDFKTEAAIYLUQP-WNHJEKBPSA-L
- molecular weight:
- 672.921
- Synonym(s):
- 16:0-18:1-PA
- 1-palmitoyl-2-(11Z-octadecenoyl)-sn-glycerol-3-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CCCCCCCCCCC(OC(COC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.
