Difference between revisions of "CPD-14876"

Latest revision as of 19:19, 21 March 2018

"CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_569 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] ==
-* left end position:
+* smiles:
-** 14232
+** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)
-* transcription direction:
+* common name:
-** POSITIVE
+** 3-acetylamino-4-hydroxybenzaldehyde
-* right end position:
+* inchi key:
-** 15253
+** InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M
-* centisome position:
+* molecular weight:
-** 45.226894
+** 178.167
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[ATPASE-RXN]]
+== Reaction(s) known to produce the compound ==
-** in-silico_annotation
+== Reaction(s) of unknown directionality ==
-***ec-number
+* [[RXN-13871]]
-== Pathways associated ==
 == External links  ==
-{{#set: left end position=14232}}
+* PUBCHEM:
-{{#set: transcription direction=POSITIVE}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657664 90657664]
-{{#set: right end position=15253}}
+{{#set: smiles=CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)}}
-{{#set: centisome position=45.226894    }}
+{{#set: common name=3-acetylamino-4-hydroxybenzaldehyde}}
-{{#set: reaction associated=ATPASE-RXN}}
+{{#set: inchi key=InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M}}
+{{#set: molecular weight=178.167    }}
+{{#set: reversible reaction associated=RXN-13871}}