Difference between revisions of "CPD-7649"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5384 PWY-5384] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * common name: ** d...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5384 PWY-5384] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
+
** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)
 
* common name:
 
* common name:
** sucrose degradation IV (sucrose phosphorylase)
+
** dopamine 3-O-sulfate
 +
* inchi key:
 +
** InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 233.239   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
 +
** 4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[FRUCTOKINASE-RXN]]
+
* [[RXN6666-9]]
** 3 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Tiso_gene_1303]]
+
*** [[Tiso_gene_17974]]
+
*** [[Tiso_gene_3107]]
+
** 4 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[orthology-creinhardtii]]
+
*** [[annotation-experimental_annotation]]
+
* [[PGLUCISOM-RXN]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_19480]]
+
** 3 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-esiliculosus]]
+
* [[PHOSPHOGLUCMUT-RXN]]
+
** 2 associated gene(s):
+
*** [[Tiso_gene_4816]]
+
*** [[Tiso_gene_13477]]
+
** 3 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
*** [[manual-primary_network]]
+
*** [[annotation-experimental_annotation]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-PHOSPHORYLASE-RXN SUCROSE-PHOSPHORYLASE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-201174}}
+
* LIGAND-CPD:
{{#set: common name=sucrose degradation IV (sucrose phosphorylase)}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C13690 C13690]
{{#set: reaction found=3}}
+
* HMDB : HMDB06275
{{#set: total reaction=4}}
+
* CHEBI:
{{#set: completion rate=75.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133524 133524]
 +
* METABOLIGHTS : MTBLC37946
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201578 25201578]
 +
{{#set: smiles=C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)}}
 +
{{#set: common name=dopamine 3-O-sulfate}}
 +
{{#set: inchi key=InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=233.239    }}
 +
{{#set: common name=5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate|4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)}}
 +
{{#set: produced by=RXN6666-9}}

Latest revision as of 20:19, 21 March 2018

Metabolite CPD-7649

  • smiles:
    • C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)
  • common name:
    • dopamine 3-O-sulfate
  • inchi key:
    • InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N
  • molecular weight:
    • 233.239
  • Synonym(s):
    • 5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
    • 4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)" cannot be used as a page name in this wiki.