Difference between revisions of "RXN-17010"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * smiles: ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17010 RXN-17010] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17010 RXN-17010] ==
−
* smiles:
+
* direction:
−
** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N
+
 
* common name:
 
* common name:
−
** 4'-apo-β-carotenal
+
** 1-acylglycerol-3-phosphate_o-acyltransferase
−
* molecular weight:
+
* ec number:
−
** 482.748   
+
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
 
* Synonym(s):
 
* Synonym(s):
−
** β-apo-4'-carotenal
 
−
** 4'-apo-β,ψ-caroten-4'-al
 
−
** 4'-apo-β,ψ-carotenal
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11989]]
+
** 1 [[1-PALMITOYLGLYCEROL-3-PHOSPHATE]][c] '''+''' 1 [[CPD-18346]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-18352]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 1-palmitoylglycerol 3-phosphate[c] '''+''' 1 cis-vaccenoyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 1-palmitoyl-2-cis-vaccenoyl phosphatidate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13959]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19892 C19892]
+
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.3.1.51}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53157 53157]
+
{{#set: gene associated=Tiso_gene_13959}}
−
* PUBCHEM:
+
{{#set: in pathway=}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44224033 44224033]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
{{#set: inchi key=InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=4'-apo-β-carotenal}}
+
−
{{#set: molecular weight=482.748    }}
+
−
{{#set: common name=β-apo-4'-carotenal|4'-apo-β,ψ-caroten-4'-al|4'-apo-β,ψ-carotenal}}
+
−
{{#set: produced by=RXN-11989}}
+

Latest revision as of 19:19, 21 March 2018

Reaction RXN-17010

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 1-acylglycerol-3-phosphate_o-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17010&oldid=40916"