Difference between revisions of "CPD-8222"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17272 CPD-17272] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCCCCCCCCC)CO)=O * inch...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8222 CPD-8222] == * smiles: ** C=C(C1(CC(C(CC1)(C)O)O))C * common name: ** (1S,2S,4R)-limon...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8222 CPD-8222] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C=C(C1(CC(C(CC1)(C)O)O))C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (1S,2S,4R)-limonene-1,2-diol |
| + | * inchi key: | ||
| + | ** InChIKey=WKZWTZTZWGWEGE-UTLUCORTSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 170.251 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (1R,2R,4S)-menth-8-ene-1,2-diol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.3.2.8-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-9464]] |
== External links == | == External links == | ||
| + | * UM-BBD-CPD : c0673 | ||
| + | * LIPID_MAPS : LMPR0102090016 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441246 441246] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C07276 C07276] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.390019.html 390019] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18515 18515] |
| − | {{#set: smiles= | + | {{#set: smiles=C=C(C1(CC(C(CC1)(C)O)O))C}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=(1S,2S,4R)-limonene-1,2-diol}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=WKZWTZTZWGWEGE-UTLUCORTSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=170.251 }} |
| − | {{#set: | + | {{#set: common name=(1R,2R,4S)-menth-8-ene-1,2-diol}} |
| + | {{#set: produced by=3.3.2.8-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-9464}} | ||
Latest revision as of 19:20, 21 March 2018
Contents
Metabolite CPD-8222
- smiles:
- C=C(C1(CC(C(CC1)(C)O)O))C
- common name:
- (1S,2S,4R)-limonene-1,2-diol
- inchi key:
- InChIKey=WKZWTZTZWGWEGE-UTLUCORTSA-N
- molecular weight:
- 170.251
- Synonym(s):
- (1R,2R,4S)-menth-8-ene-1,2-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- UM-BBD-CPD : c0673
- LIPID_MAPS : LMPR0102090016
- PUBCHEM:
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
