Difference between revisions of "Cis-cis-D17-35-3-oxo-C54-2-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * common name: ** 2-car...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D17-35-3-oxo-C54-2-ACPs cis-cis-D17-35-3-oxo-C54-2-ACPs] == * common name: ** a cis,cis...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D17-35-3-oxo-C54-2-ACPs cis-cis-D17-35-3-oxo-C54-2-ACPs] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a cis,cis-delta17,35-3-oxo-C54:2-[acp] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1G-184]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a cis,cis-delta17,35-3-oxo-C54:2-[acp]}} | |
| − | + | {{#set: consumed by=RXN1G-184}} | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | + | ||
Latest revision as of 20:20, 21 March 2018
Contents
Metabolite cis-cis-D17-35-3-oxo-C54-2-ACPs
- common name:
- a cis,cis-delta17,35-3-oxo-C54:2-[acp]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a cis,cis-delta17,35-3-oxo-C54:2-[acp" cannot be used as a page name in this wiki.
