Difference between revisions of "PWY-5047"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * smiles: ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047] ==
−
* smiles:
+
* taxonomic range:
−
** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
−
** InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
+
 
* common name:
 
* common name:
−
** ppGpp
+
** gibberellin biosynthesis IV (Gibberella fujikuroi)
−
* molecular weight:
+
−
** 598.123   
+
 
* Synonym(s):
 
* Synonym(s):
−
** guanosine tetraphosphate
+
** GA3 biosynthesis
−
** guanosine 5'-diphosphate,3'-diphosphate
+
−
** guanosine 3',5'-bispyrophosphate
+
−
** guanosine 3',5'-bis(diphosphate)
+
−
** guanosine 3'-diphosphate 5'-diphosphate
+
−
** magic spot
+
−
** guanosine-5',3'-tetraphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[PPGPPSYN-RXN]]
+
'''6''' reactions found over '''15''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[1.14.13.78-RXN]]
−
* [[GDPPYPHOSKIN-RXN]]
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_1547]]
−
* [[GBDP]]
+
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
* [[1.14.13.79-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
*** [[Tiso_gene_3577]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-5242]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_8263]]
 +
*** [[Tiso_gene_1547]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
* [[RXN-7580]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_1547]]
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
* [[RXN1F-160]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3577]]
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN1F-161]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3577]]
 +
*** [[Tiso_gene_8263]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6545 RXN-6545]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6549 RXN-6549]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7617 RXN-7617]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7619 RXN-7619]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7621 RXN-7621]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7624 RXN-7624]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7625 RXN-7625]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7634 RXN-7634]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-166 RXN1F-166]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB04022
+
{{#set: taxonomic range=TAX-4751}}
−
* PUBCHEM:
+
{{#set: common name=gibberellin biosynthesis IV (Gibberella fujikuroi)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15938967 15938967]
+
{{#set: common name=GA3 biosynthesis}}
−
* HMDB : HMDB59638
+
{{#set: reaction found=6}}
−
* LIGAND-CPD:
+
{{#set: total reaction=15}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01228 C01228]
+
{{#set: completion rate=40.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13082026.html 13082026]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77828 77828]
+
−
* BIGG : ppgpp
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I}}
+
−
{{#set: common name=ppGpp}}
+
−
{{#set: molecular weight=598.123    }}
+
−
{{#set: common name=guanosine tetraphosphate|guanosine 5'-diphosphate,3'-diphosphate|guanosine 3',5'-bispyrophosphate|guanosine 3',5'-bis(diphosphate)|guanosine 3'-diphosphate 5'-diphosphate|magic spot|guanosine-5',3'-tetraphosphate}}
+
−
{{#set: consumed by=PPGPPSYN-RXN}}
+
−
{{#set: produced by=GDPPYPHOSKIN-RXN}}
+
−
{{#set: consumed or produced by=GBDP}}
+

Latest revision as of 19:20, 21 March 2018

Pathway PWY-5047

  • taxonomic range:
  • common name:
    • gibberellin biosynthesis IV (Gibberella fujikuroi)
  • Synonym(s):
    • GA3 biosynthesis

Reaction(s) found

6 reactions found over 15 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5047&oldid=40980"