Difference between revisions of "CPD-12935"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14141 == * left end position: ** 1300 * transcription direction: ** POSITIVE * right end position: ** 1959 * centisome position: ** 22.3713...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * smiles: ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1) |
| − | * | + | * common name: |
| − | ** | + | ** 4'-apo-β-carotenal |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 482.748 |
* Synonym(s): | * Synonym(s): | ||
| + | ** β-apo-4'-carotenal | ||
| + | ** 4'-apo-β,ψ-caroten-4'-al | ||
| + | ** 4'-apo-β,ψ-carotenal | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-11989]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19892 C19892] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53157 53157] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44224033 44224033] |
| + | {{#set: smiles=CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)}} | ||
| + | {{#set: common name=4'-apo-β-carotenal}} | ||
| + | {{#set: inchi key=InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N}} | ||
| + | {{#set: molecular weight=482.748 }} | ||
| + | {{#set: common name=β-apo-4'-carotenal|4'-apo-β,ψ-caroten-4'-al|4'-apo-β,ψ-carotenal}} | ||
| + | {{#set: produced by=RXN-11989}} | ||
Latest revision as of 19:20, 21 March 2018
Contents
Metabolite CPD-12935
- smiles:
- CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)
- common name:
- 4'-apo-β-carotenal
- inchi key:
- InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N
- molecular weight:
- 482.748
- Synonym(s):
- β-apo-4'-carotenal
- 4'-apo-β,ψ-caroten-4'-al
- 4'-apo-β,ψ-carotenal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
