Difference between revisions of "PWY-5951"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5951 PWY-5951] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5951 PWY-5951] ==
* smiles:
+
* taxonomic range:
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
+
 
* common name:
 
* common name:
** gibberellin A20
+
** (R,R)-butanediol biosynthesis
* molecular weight:
+
** 331.388   
+
 
* Synonym(s):
 
* Synonym(s):
** GA20
+
** (R,R)-butylene glycol fermentation
 +
** (R,R)-butanediol fermentation
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-113]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
* [[RXN1F-169]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_8778]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201798 25201798]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: common name=(R,R)-butanediol biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742]
+
{{#set: common name=(R,R)-butylene glycol fermentation|(R,R)-butanediol fermentation}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035]
+
{{#set: total reaction=1}}
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: completion rate=100.0}}
{{#set: inchi key=InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M}}
+
{{#set: common name=gibberellin A20}}
+
{{#set: molecular weight=331.388    }}
+
{{#set: common name=GA20}}
+
{{#set: consumed by=RXN-113}}
+
{{#set: produced by=RXN1F-169}}
+

Latest revision as of 20:20, 21 March 2018

Pathway PWY-5951

  • taxonomic range:
  • common name:
    • (R,R)-butanediol biosynthesis
  • Synonym(s):
    • (R,R)-butylene glycol fermentation
    • (R,R)-butanediol fermentation

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links