Difference between revisions of "PWY-5034"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8984 CPD-8984] == * smiles: ** C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3) * inchi key: ** InChIK...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** GA12 biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** gibberellin A12 biosynthesis | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''6''' reactions found over '''6''' reactions in the full pathway | |
| − | + | * [[1.14.13.78-RXN]] | |
| − | * [[ | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_1547]] | ||
| + | *** [[Tiso_gene_8263]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | * [[1.14.13.79-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_8263]] | ||
| + | *** [[Tiso_gene_3577]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-5242]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_8263]] | ||
| + | *** [[Tiso_gene_1547]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | * [[RXN-7580]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_1547]] | ||
| + | *** [[Tiso_gene_8263]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | * [[RXN1F-160]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_3577]] | ||
| + | *** [[Tiso_gene_8263]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN1F-161]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_3577]] | ||
| + | *** [[Tiso_gene_8263]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5034 PWY-5034] |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=GA12 biosynthesis}} | |
| − | + | {{#set: common name=gibberellin A12 biosynthesis}} | |
| − | + | {{#set: reaction found=6}} | |
| − | + | {{#set: total reaction=6}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:20, 21 March 2018
Pathway PWY-5034
- taxonomic range:
- common name:
- GA12 biosynthesis
- Synonym(s):
- gibberellin A12 biosynthesis
Reaction(s) found
6 reactions found over 6 reactions in the full pathway
- 1.14.13.78-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- 1.14.13.79-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-5242
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-7580
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN1F-160
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN1F-161
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
