Difference between revisions of "RXN1F-168"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-168 RXN1F-168] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-168 RXN1F-168] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.14.11.12 EC-1.14.11.12] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1 [[CPD-10332]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD1F-96]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[WATER]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 gibberellin44 (open lactone form)[c] '''+''' 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''=>''' 1 CO2[c] '''+''' 1 gibberellin A19[c] '''+''' 1 succinate[c] '''+''' 1 H2O[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Tiso_gene_3330]] | |
− | + | ** Source: [[orthology-athaliana]] | |
− | + | == Pathways == | |
− | + | * [[PWY-5035]], gibberellin biosynthesis III (early C-13 hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5035 PWY-5035] | |
− | + | ** '''3''' reactions found over '''7''' reactions in the full pathway | |
− | + | == Reconstruction information == | |
− | + | * Category: [[orthology]] | |
− | + | ** Source: [[orthology-athaliana]] | |
− | + | *** Tool: [[pantograph]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16033 16033] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07184 R07184] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.14.11.12}} | |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_3330}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-5035}} |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-athaliana}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:20, 21 March 2018
Contents
Reaction RXN1F-168
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-10332[c] + 1 2-KETOGLUTARATE[c] + 1 OXYGEN-MOLECULE[c] => 1 CARBON-DIOXIDE[c] + 1 CPD1F-96[c] + 1 SUC[c] + 1 WATER[c]
- With common name(s):
- 1 gibberellin44 (open lactone form)[c] + 1 2-oxoglutarate[c] + 1 oxygen[c] => 1 CO2[c] + 1 gibberellin A19[c] + 1 succinate[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3330
- Source: orthology-athaliana
Pathways
- PWY-5035, gibberellin biosynthesis III (early C-13 hydroxylation): PWY-5035
- 3 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-athaliana
External links