Difference between revisions of "CPD-13935"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6305 PWY-6305] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] == * smiles: ** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2) * common...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6305 PWY-6305] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)
 
* common name:
 
* common name:
** putrescine biosynthesis IV
+
** α1,6-D mannobiose
 +
* inchi key:
 +
** InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N
 +
* molecular weight:
 +
** 342.299   
 
* Synonym(s):
 
* Synonym(s):
** putrescine biosynthesis in plants
+
** α-D-mannosyl-(1->6)-D-mannose
** ODC and ADC putrescine biosynthesis
+
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''3''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[ARGINASE-RXN]]
+
* [[3.2.1.152-RXN]]
** [[AGMATIN-RXN]]
+
== Reaction(s) of unknown directionality ==
** [[ORNDECARBOX-RXN]]
+
== Reaction(s) not found ==
+
* '''1''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=ARGDECARBOX-RXN ARGDECARBOX-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33090}}
+
* LIGAND-CPD:
{{#set: common name=putrescine biosynthesis IV}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01728 C01728]
{{#set: common name=putrescine biosynthesis in plants|ODC and ADC putrescine biosynthesis}}
+
* CHEMSPIDER:
{{#set: reaction found=3}}
+
** [http://www.chemspider.com/Chemical-Structure.388648.html 388648]
{{#set: reaction not found=1}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62357 62357]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439557 439557]
 +
{{#set: smiles=C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)}}
 +
{{#set: common name=α1,6-D mannobiose}}
 +
{{#set: inchi key=InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N}}
 +
{{#set: molecular weight=342.299    }}
 +
{{#set: common name=α-D-mannosyl-(1->6)-D-mannose}}
 +
{{#set: produced by=3.2.1.152-RXN}}

Latest revision as of 19:21, 21 March 2018

Metabolite CPD-13935

  • smiles:
    • C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)
  • common name:
    • α1,6-D mannobiose
  • inchi key:
    • InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N
  • molecular weight:
    • 342.299
  • Synonym(s):
    • α-D-mannosyl-(1->6)-D-mannose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



"α-D-mannosyl-(1->6)-D-mannose" cannot be used as a page name in this wiki.