Difference between revisions of "CPD1F-140"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
 
* common name:
 
* common name:
** GA12 biosynthesis
+
** gibberellin A20
 +
* inchi key:
 +
** InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
 +
* molecular weight:
 +
** 331.388   
 
* Synonym(s):
 
* Synonym(s):
** gibberellin A12 biosynthesis
+
** GA20
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''6''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN-113]]
* [[1.14.13.78-RXN]]
+
== Reaction(s) known to produce the compound ==
* [[1.14.13.79-RXN]]
+
* [[RXN1F-169]]
* [[RXN-5242]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-7580]]
+
* [[RXN1F-160]]
+
* [[RXN1F-161]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
* ARACYC:
+
* PUBCHEM:
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5034 PWY-5034]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201798 25201798]
{{#set: taxonomic range=TAX-33090}}
+
* CHEBI:
{{#set: common name=GA12 biosynthesis}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742]
{{#set: common name=gibberellin A12 biosynthesis}}
+
* LIGAND-CPD:
{{#set: reaction found=6}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035]
{{#set: reaction not found=6}}
+
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
{{#set: completion rate=100.0}}
+
{{#set: common name=gibberellin A20}}
 +
{{#set: inchi key=InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M}}
 +
{{#set: molecular weight=331.388    }}
 +
{{#set: common name=GA20}}
 +
{{#set: consumed by=RXN-113}}
 +
{{#set: produced by=RXN1F-169}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD1F-140

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • common name:
    • gibberellin A20
  • inchi key:
    • InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
  • molecular weight:
    • 331.388
  • Synonym(s):
    • GA20

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.