Difference between revisions of "PWY-7176"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7176 PWY-7176] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7176 PWY-7176] ==
* smiles:
+
* taxonomic range:
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
** InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** gibberellin A20
+
** UTP and CTP de novo biosynthesis
* molecular weight:
+
** 331.388   
+
 
* Synonym(s):
 
* Synonym(s):
** GA20
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-113]]
+
'''3''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[CTPSYN-RXN]]
* [[RXN1F-169]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-12002]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_17057]]
 +
*** [[Tiso_gene_14116]]
 +
*** [[Tiso_gene_2386]]
 +
*** [[Tiso_gene_9739]]
 +
*** [[Tiso_gene_19734]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[UDPKIN-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_16529]]
 +
*** [[Tiso_gene_18224]]
 +
*** [[Tiso_gene_17272]]
 +
*** [[Tiso_gene_9290]]
 +
*** [[Tiso_gene_195]]
 +
*** [[Tiso_gene_17271]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201798 25201798]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7176 PWY-7176]
* CHEBI:
+
{{#set: taxonomic range=TAX-2157}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742]
+
{{#set: taxonomic range=TAX-2759}}
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035]
+
{{#set: common name=UTP and CTP de novo biosynthesis}}
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: reaction found=3}}
{{#set: inchi key=InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M}}
+
{{#set: total reaction=3}}
{{#set: common name=gibberellin A20}}
+
{{#set: completion rate=100.0}}
{{#set: molecular weight=331.388    }}
+
{{#set: common name=GA20}}
+
{{#set: consumed by=RXN-113}}
+
{{#set: produced by=RXN1F-169}}
+

Latest revision as of 19:21, 21 March 2018

Pathway PWY-7176

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links