|
|
(3 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.14-RXN 3.2.1.14-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4)))) |
| * common name: | | * common name: |
− | ** glycoside_hydrolase_family_18_protein | + | ** MoO2-molybdopterin cofactor |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/3.2.1.14 EC-3.2.1.14] | + | ** InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J |
| + | * molecular weight: |
| + | ** 519.251 |
| * Synonym(s): | | * Synonym(s): |
| + | ** MoCo (dioxyo) |
| + | ** molybdenum cofactor (dioxyo) |
| + | ** MoO2(OH)Dtpp-mP |
| + | ** {[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate |
| + | ** MoO2-Mo-MPT |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[WATER]][c] '''+''' 1 [[CHITIN]][c] '''=>''' 2 [[Chitodextrins]][c]
| + | * [[RXN-8348]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 H2O[c] '''+''' 1 chitin[c] '''=>''' 2 a chitodextrin[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_10265]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | * [[PWY-7822]], chitin degradation III (Serratia): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7822 PWY-7822]
| + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-6902]], chitin degradation II (Vibrio): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6902 PWY-6902]
| + | |
− | ** '''3''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6855]], chitin degradation I (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6855 PWY-6855] | + | |
− | ** '''1''' reactions found over '''7''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * UNIPROT: | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P07254 P07254] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70680283 70680283] |
− | ** [http://www.uniprot.org/uniprot/P23951 P23951]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P17541 P17541]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71302 71302] |
− | ** [http://www.uniprot.org/uniprot/P29030 P29030] | + | {{#set: smiles=C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))}} |
− | ** [http://www.uniprot.org/uniprot/P20533 P20533] | + | {{#set: common name=MoO2-molybdopterin cofactor}} |
− | ** [http://www.uniprot.org/uniprot/P29029 P29029]
| + | {{#set: inchi key=InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J}} |
− | ** [http://www.uniprot.org/uniprot/P27050 P27050]
| + | {{#set: molecular weight=519.251 }} |
− | ** [http://www.uniprot.org/uniprot/P11218 P11218]
| + | {{#set: common name=MoCo (dioxyo)|molybdenum cofactor (dioxyo)|MoO2(OH)Dtpp-mP|{[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate|MoO2-Mo-MPT}} |
− | ** [http://www.uniprot.org/uniprot/P29115 P29115]
| + | {{#set: produced by=RXN-8348}} |
− | ** [http://www.uniprot.org/uniprot/Q54501 Q54501]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19172 P19172]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29026 P29026]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q23737 Q23737]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36362 P36362]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19171 P19171]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29027 P29027]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29116 P29116]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9R5K8 Q9R5K8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M233 Q7M233]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9R5K7 Q9R5K7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CE95 Q9CE95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59145 Q59145]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9FRV1 Q9FRV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q56077 Q56077]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40667 Q40667]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40668 Q40668]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S9F7 Q9S9F7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54196 P54196]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49824 O49824]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49825 O49825]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49826 O49826]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49827 O49827]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7GCM7 Q7GCM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22080 O22080]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49830 O49830]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SXY2 Q9SXY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/O60994 O60994]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RHU3 Q9RHU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SLP4 Q9SLP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RHU5 Q9RHU5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RHU4 Q9RHU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1Q9 Q7M1Q9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M443 Q7M443]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S7G9 Q9S7G9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11220 P11220]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59924 Q59924]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9FRV0 Q9FRV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36361 P36361]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32470 P32470]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92223 Q92223]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1R1 Q7M1R1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14529 P14529]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S8X7 Q9S8X7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11955 P11955]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11797 P11797]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05315 P05315]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08252 P08252]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24626 P24626]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25765 P25765]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27054 P27054]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17513 P17513]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17514 P17514]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29021 P29021]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24091 P24091]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29059 P29059]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29060 P29060]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29061 P29061]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06209 Q06209]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43184 Q43184]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36908 P36908]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05638 Q05638]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29025 P29025]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29024 P29024]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05537 Q05537]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05540 Q05540]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05539 Q05539]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05538 Q05538]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41539 Q41539]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43294 Q43294]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52405 P52405]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42820 P42820]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12735 Q12735]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43764 Q43764]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43765 Q43765]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40114 Q40114]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43591 Q43591]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43151 Q43151]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43150 Q43150]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42421 Q42421]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q54276 Q54276]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42995 Q42995]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21226 P21226]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43683 Q43683]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43684 Q43684]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12631 Q12631]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36907 P36907]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09023 Q09023]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12713 Q12713]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52403 P52403]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52404 P52404]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52406 P52406]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43322 Q43322]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42515 Q42515]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59141 Q59141]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59142 Q59142]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59143 Q59143]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59144 Q59144]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42878 Q42878]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93154 P93154]
| + | |
− | ** [http://www.uniprot.org/uniprot/O50076 O50076]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZSI6 Q9ZSI6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93518 P93518]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24007 O24007]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41794 Q41794]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41795 Q41795]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42970 Q42970]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04138 O04138]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04272 O04272]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42993 Q42993]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42839 Q42839]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48642 O48642]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43852 Q43852]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81144 O81144]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81145 O81145]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65213 O65213]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40838 Q40838]
| + | |
− | ** [http://www.uniprot.org/uniprot/P94084 P94084]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43752 Q43752]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39656 Q39656]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39657 Q39657]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23472 P23472]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39799 Q39799]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39785 Q39785]
| + | |
− | ** [http://www.uniprot.org/uniprot/O17412 O17412]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04222 O04222]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96408 Q96408]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96409 Q96409]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96410 Q96410]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96411 Q96411]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q84577 Q84577]
| + | |
− | ** [http://www.uniprot.org/uniprot/P92013 P92013]
| + | |
− | ** [http://www.uniprot.org/uniprot/P96156 P96156]
| + | |
− | ** [http://www.uniprot.org/uniprot/P75020 P75020]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YMQ7 Q9YMQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZIX4 Q9ZIX4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q11174 Q11174]
| + | |
− | ** [http://www.uniprot.org/uniprot/O44079 O44079]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: common name=glycoside_hydrolase_family_18_protein}} | + | |
− | {{#set: ec number=EC-3.2.1.14}} | + | |
− | {{#set: gene associated=Tiso_gene_10265}} | + | |
− | {{#set: in pathway=PWY-7822|PWY-6902|PWY-6855}} | + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=in-silico_annotation}} | + | |