Difference between revisions of "CRPB-all-trans-Retinol"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CRPB-all-trans-Retinol CRPB-all-trans-Retinol] == * common name: ** an all-trans retinol-[cellu...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CRPB-all-trans-Retinol CRPB-all-trans-Retinol] ==
* smiles:
+
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1)
+
* inchi key:
+
** InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N
+
 
* common name:
 
* common name:
** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
+
** an all-trans retinol-[cellular-retinol-binding-protein]
* molecular weight:
+
** 683.068   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14177]]
+
* [[RXN-12581]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=an all-trans retinol-[cellular-retinol-binding-protein]}}
** [http://www.genome.jp/dbget-bin/www_bget?C05813 C05813]
+
{{#set: consumed by=RXN-12581}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28423 28423]
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280835 5280835]
+
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1)}}
+
{{#set: inchi key=InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N}}
+
{{#set: common name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}}
+
{{#set: molecular weight=683.068    }}
+
{{#set: consumed by=RXN-14177}}
+

Latest revision as of 19:21, 21 March 2018

Metabolite CRPB-all-trans-Retinol

  • common name:
    • an all-trans retinol-[cellular-retinol-binding-protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an all-trans retinol-[cellular-retinol-binding-protein" cannot be used as a page name in this wiki.