Difference between revisions of "PWY-6365"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TAGATURONATE D-TAGATURONATE] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** I...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6365 PWY-6365] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6365 PWY-6365] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** D- | + | ** D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''4''' reactions found over '''4''' reactions in the full pathway | |
− | + | * [[2.7.1.133-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_15232]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[2.7.1.134-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_15232]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[2.7.1.140-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-10955]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name=D- | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:21, 21 March 2018
Pathway PWY-6365
- taxonomic range:
- common name:
- D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis
- Synonym(s):
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- 2.7.1.133-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- 2.7.1.134-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- 2.7.1.140-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-10955
- 0 associated gene:
- 1 reconstruction source(s) associated: