Difference between revisions of "DIHYDRO-DIOH-BENZOATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7619 PWY-7619] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * comm...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C([O-])(=O)C1(=CC=CC(C1O)O) |
* common name: | * common name: | ||
− | ** | + | ** (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate |
+ | * inchi key: | ||
+ | ** InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M | ||
+ | * molecular weight: | ||
+ | ** 155.13 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[DHBDEHYD-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266758 45266758] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.19951064.html 19951064] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58764 58764] | ||
+ | * BIGG : 23ddhb | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04171 C04171] | ||
+ | {{#set: smiles=C([O-])(=O)C1(=CC=CC(C1O)O)}} | ||
+ | {{#set: common name=(2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate}} | ||
+ | {{#set: inchi key=InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M}} | ||
+ | {{#set: molecular weight=155.13 }} | ||
+ | {{#set: consumed by=DHBDEHYD-RXN}} |
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite DIHYDRO-DIOH-BENZOATE
- smiles:
- C([O-])(=O)C1(=CC=CC(C1O)O)
- common name:
- (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate
- inchi key:
- InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M
- molecular weight:
- 155.13
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(=CC=CC(C1O)O)" cannot be used as a page name in this wiki.