Difference between revisions of "CPD-15818"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11481 RXN-11481] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carrier...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-ribose...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11481 RXN-11481] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** [CH](=O)C(O)C(O)C(O)CO
 
* common name:
 
* common name:
** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
+
** aldehydo-D-ribose
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
+
** InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
 +
* molecular weight:
 +
** 150.131   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[3-hydroxypimeloyl-ACP-methyl-esters]][c] '''=>''' 1 [[Enoylpimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[RXN-14883]]
** 1 a (3R)-3-hydroxypimeloyl-[acp] methyl ester[c] '''=>''' 1 an enoylpimeloyl-[acp] methyl ester[c] '''+''' 1 H2O[c]
+
* [[RXN-14882]]
 
+
* [[RXN0-5305]]
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_6885]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[Tiso_gene_6884]]
+
** EXPERIMENTAL_ANNOTATION
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
+
** '''9''' reactions found over '''11''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[creinhardtii]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[experimental_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5311110 5311110]
{{#set: ec number=EC-4.2.1.59}}
+
* CHEBI:
{{#set: gene associated=Tiso_gene_6885|Tiso_gene_6884}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47014 47014]
{{#set: in pathway=PWY-6519}}
+
* METABOLIGHTS : MTBLC47014
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=aldehydo-D-ribose}}
{{#set: reconstruction source=creinhardtii}}
+
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N}}
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=150.131    }}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reversible reaction associated=RXN-14883|RXN-14882|RXN0-5305}}
{{#set: reconstruction source=experimental_annotation}}
+

Latest revision as of 19:21, 21 March 2018

Metabolite CPD-15818

  • smiles:
    • [CH](=O)C(O)C(O)C(O)CO
  • common name:
    • aldehydo-D-ribose
  • inchi key:
    • InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
  • molecular weight:
    • 150.131
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.