Difference between revisions of "Tiso gene 6180"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13755 CPD-13755] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_6180 == * right end position: ** 11601 * transcription direction: ** POSITIVE * left end position: ** 56 * centisome position: ** 0.4491498...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13755 CPD-13755] ==
+
== Gene Tiso_gene_6180 ==
* smiles:
+
* right end position:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
** 11601
* inchi key:
+
* transcription direction:
** InChIKey=AKNIQSRWPADUMX-ODLRQIBISA-J
+
** POSITIVE
* common name:
+
* left end position:
** 5-hydroxy-3-[(3aS,4S,5R,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA
+
** 56
* molecular weight:
+
* centisome position:
** 985.786    
+
** 0.44914982    
 
* Synonym(s):
 
* Synonym(s):
** 5OH-HIP-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
* [[RXN-12747]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=11601}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86290216 86290216]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=56}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83738 83738]
+
{{#set: centisome position=0.44914982   }}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
{{#set: inchi key=InChIKey=AKNIQSRWPADUMX-ODLRQIBISA-J}}
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
{{#set: common name=5-hydroxy-3-[(3aS,4S,5R,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA}}
+
{{#set: molecular weight=985.786   }}
+
{{#set: common name=5OH-HIP-CoA}}
+
{{#set: produced by=RXN-12747}}
+

Latest revision as of 20:21, 21 March 2018

Gene Tiso_gene_6180

  • right end position:
    • 11601
  • transcription direction:
    • POSITIVE
  • left end position:
    • 56
  • centisome position:
    • 0.44914982
  • Synonym(s):

Reactions associated

Pathways associated

External links