Difference between revisions of "PWYQT-4427"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4427 PWYQT-4427] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4427 PWYQT-4427] ==
* smiles:
+
* taxonomic range:
** C12(NC(=O)NC=1C(=O)NC(=O)N2)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33634 TAX-33634]
** InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
** urate
+
** sulfoquinovosyl diacylglycerol biosynthesis
* molecular weight:
+
** 168.112   
+
 
* Synonym(s):
 
* Synonym(s):
** 2,6,8-trioxypurine
+
** SQDG biosynthesis
** purine-2,6,8-(1H,3H,9H)-trione
+
** 7,9-dihydro-1H-purine-2,6,8(3H)-trione
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''2''' reactions in the full pathway
* [[XANTHINE-OXIDASE-RXN]]
+
* [[RXN-1223]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
* [[URATEtm]]
+
*** [[Tiso_gene_2295]]
* [[RXN0-901]]
+
** 4 reconstruction source(s) associated:
* [[URATEt]]
+
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-1224]]
 +
** 11 associated gene(s):
 +
*** [[Tiso_gene_7966]]
 +
*** [[Tiso_gene_17894]]
 +
*** [[Tiso_gene_12341]]
 +
*** [[Tiso_gene_11792]]
 +
*** [[Tiso_gene_9428]]
 +
*** [[Tiso_gene_10734]]
 +
*** [[Tiso_gene_412]]
 +
*** [[Tiso_gene_3385]]
 +
*** [[Tiso_gene_19034]]
 +
*** [[Tiso_gene_10863]]
 +
*** [[Tiso_gene_15050]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 69-93-2
+
{{#set: taxonomic range=TAX-2}}
* Wikipedia : Uric_acid
+
{{#set: taxonomic range=TAX-33634}}
* METABOLIGHTS : MTBLC17775
+
{{#set: taxonomic range=TAX-2763}}
* DRUGBANK : DB01696
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: common name=sulfoquinovosyl diacylglycerol biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229235 44229235]
+
{{#set: common name=SQDG biosynthesis}}
* HMDB : HMDB00289
+
{{#set: reaction found=2}}
* LIGAND-CPD:
+
{{#set: total reaction=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C00366 C00366]
+
{{#set: completion rate=100.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17775 17775]
+
* BIGG : urate
+
{{#set: smiles=C12(NC(=O)NC=1C(=O)NC(=O)N2)}}
+
{{#set: inchi key=InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N}}
+
{{#set: common name=urate}}
+
{{#set: molecular weight=168.112    }}
+
{{#set: common name=2,6,8-trioxypurine|purine-2,6,8-(1H,3H,9H)-trione|7,9-dihydro-1H-purine-2,6,8(3H)-trione}}
+
{{#set: produced by=XANTHINE-OXIDASE-RXN}}
+
{{#set: consumed or produced by=URATEtm|RXN0-901|URATEt}}
+

Latest revision as of 19:22, 21 March 2018

Pathway PWYQT-4427

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links