Difference between revisions of "PWY-7416"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-468 CPD-468] == * smiles: ** C([O-])(=O)CCCC(C(=O)[O-])[N+] * inchi key: ** InChIKey=OYIFNH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7416 PWY-7416] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7416 PWY-7416] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phospholipid remodeling (phosphatidylcholine, yeast) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''3''' reactions in the full pathway | |
− | * [[RXN- | + | * [[RXN-15065]] |
− | * [[ | + | ** 4 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_15046]] |
− | + | *** [[Tiso_gene_12960]] | |
− | * [[ | + | *** [[Tiso_gene_15047]] |
− | * [[2- | + | *** [[Tiso_gene_12959]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-15066]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_10604]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-1641]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=phospholipid remodeling (phosphatidylcholine, yeast)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:22, 21 March 2018
Pathway PWY-7416
- taxonomic range:
- common name:
- phospholipid remodeling (phosphatidylcholine, yeast)
- Synonym(s):
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- RXN-15065
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-15066
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-1641
- 0 associated gene:
- 1 reconstruction source(s) associated: