Difference between revisions of "CPD-15651"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7596 == * Synonym(s): == Reactions associated == * GLUTAMINE--TRNA-LIGASE-RXN ** pantograph-esiliculosus * GUANIDINOBUTANAMI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == |
| + | * smiles: | ||
| + | ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * common name: | ||
| + | ** 6-trans-tridecenoyl-CoA | ||
| + | * inchi key: | ||
| + | ** InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J | ||
| + | * molecular weight: | ||
| + | ** 957.819 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 6E-tridecenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14785]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658572 90658572] |
| + | {{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: common name=6-trans-tridecenoyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J}} | ||
| + | {{#set: molecular weight=957.819 }} | ||
| + | {{#set: common name=6E-tridecenoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-14785}} | ||
Latest revision as of 19:22, 21 March 2018
Contents
Metabolite CPD-15651
- smiles:
- CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 6-trans-tridecenoyl-CoA
- inchi key:
- InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
- molecular weight:
- 957.819
- Synonym(s):
- 6E-tridecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
