Difference between revisions of "RXN0-7238"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13755 CPD-13755] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7238 RXN0-7238] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** long...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13755 CPD-13755] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7238 RXN0-7238] ==
* smiles:
+
* direction:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=AKNIQSRWPADUMX-ODLRQIBISA-J
+
 
* common name:
 
* common name:
** 5-hydroxy-3-[(3aS,4S,5R,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA
+
** polyketide_synthase
* molecular weight:
+
** long_chain_acyl-_synthetase
** 985.786   
+
** acyl-_synthetase
 +
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
** 5OH-HIP-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12747]]
+
** 1 [[PROTON]][e] '''+''' 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-9247]][e] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[CPD-18346]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[e] '''+''' 1 ATP[c] '''+''' 1 coenzyme A[c] '''+''' 1 cis-vaccenate[e] '''=>''' 1 H+[c] '''+''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 cis-vaccenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4191]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_348]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86290216 86290216]
+
{{#set: common name=polyketide_synthase}}
* CHEBI:
+
{{#set: common name=long_chain_acyl-_synthetase}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83738 83738]
+
{{#set: common name=acyl-_synthetase}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: common name=ORF}}
{{#set: inchi key=InChIKey=AKNIQSRWPADUMX-ODLRQIBISA-J}}
+
{{#set: ec number=EC-6.2.1.3}}
{{#set: common name=5-hydroxy-3-[(3aS,4S,5R,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_10876|Tiso_gene_13394|Tiso_gene_135|Tiso_gene_136|Tiso_gene_9394|Tiso_gene_500|Tiso_gene_4191|Tiso_gene_348|Tiso_gene_7855}}
{{#set: molecular weight=985.786    }}
+
{{#set: in pathway=}}
{{#set: common name=5OH-HIP-CoA}}
+
{{#set: reconstruction category=annotation}}
{{#set: produced by=RXN-12747}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:22, 21 March 2018

Reaction RXN0-7238

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • polyketide_synthase
    • long_chain_acyl-_synthetase
    • acyl-_synthetase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[e] + 1 ATP[c] + 1 coenzyme A[c] + 1 cis-vaccenate[e] => 1 H+[c] + 1 AMP[c] + 1 diphosphate[c] + 1 cis-vaccenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links