Difference between revisions of "CSx"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CSx CSx] == * direction: ** LEFT-TO-RIGHT * common name: ** citrate synthase, glyoxysomal * Synonym...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CSx CSx] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
+
 
* common name:
 
* common name:
** 6-trans-tridecenoyl-CoA
+
** citrate synthase, glyoxysomal
* molecular weight:
+
** 957.819   
+
 
* Synonym(s):
 
* Synonym(s):
** 6E-tridecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-14785]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ACETYL-COA]][x] '''+''' 1.0 [[WATER]][x] '''+''' 1.0 [[OXALACETIC_ACID]][x] '''=>''' 1.0 [[PROTON]][x] '''+''' 1.0 [[CIT]][x] '''+''' 1.0 [[CO-A]][x]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 acetyl-CoA[x] '''+''' 1.0 H2O[x] '''+''' 1.0 oxaloacetate[x] '''=>''' 1.0 H+[x] '''+''' 1.0 citrate[x] '''+''' 1.0 coenzyme A[x]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9603]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658572 90658572]
+
{{#set: common name=citrate synthase, glyoxysomal}}
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: gene associated=Tiso_gene_9603}}
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=6-trans-tridecenoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=957.819    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: common name=6E-tridecenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: consumed by=RXN-14785}}
+

Latest revision as of 19:22, 21 March 2018

Reaction CSx

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • citrate synthase, glyoxysomal
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 acetyl-CoA[x] + 1.0 H2O[x] + 1.0 oxaloacetate[x] => 1.0 H+[x] + 1.0 citrate[x] + 1.0 coenzyme A[x]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links