Difference between revisions of "RXN-113"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] == * smiles: ** C1(C=C(O)C(I)=CC=1OC2(=C(I)C=C(C=C(I)2)CC([N+])C(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-113 RXN-113] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.14...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-113 RXN-113] ==
−
* smiles:
+
* direction:
−
** C1(C=C(O)C(I)=CC=1OC2(=C(I)C=C(C=C(I)2)CC([N+])C(=O)[O-]))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=AUYYCJSJGJYCDS-LBPRGKRZSA-N
+
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
−
* common name:
+
−
** 3,5,3'-triiodo-L-thyronine
+
−
* molecular weight:
+
−
** 650.978   
+
 
* Synonym(s):
 
* Synonym(s):
−
** triiodothyronine
 
−
** triothyrone
 
−
** 4-(3-iodo-4-hydroxy-phenoxy)-3,5-diiodophenylalanine
 
−
** L-3,5,3'-triiodothyronine
 
−
** L-triiodothyronine
 
−
** T3
 
−
** 3,5,3'-triiodothyronine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10607]]
+
* With identifiers:
−
* [[RXN-10615]]
+
** 1 [[CPD1F-140]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-236]][c] '''+''' 1 [[SUC]][c]
−
* [[RXN-10609]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 gibberellin A20[c] '''+''' 1 oxygen[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 CO2[c] '''+''' 1 gibberellin A29[c] '''+''' 1 succinate[c]
−
* [[THYROXINE-DEIODINASE-RXN]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3330]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-102]], gibberellin inactivation I (2β-hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-102 PWY-102]
 +
** '''4''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6893-02-3
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03809 R03809]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048703 7048703]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB00265
+
{{#set: ec number=EC-1.14.11}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_3330}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02465 C02465]
+
{{#set: in pathway=PWY-102}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=533015 533015]
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
* METABOLIGHTS : MTBLC533015
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C1(C=C(O)C(I)=CC=1OC2(=C(I)C=C(C=C(I)2)CC([N+])C(=O)[O-]))}}
+
−
{{#set: inchi key=InChIKey=AUYYCJSJGJYCDS-LBPRGKRZSA-N}}
+
−
{{#set: common name=3,5,3'-triiodo-L-thyronine}}
+
−
{{#set: molecular weight=650.978    }}
+
−
{{#set: common name=triiodothyronine|triothyrone|4-(3-iodo-4-hydroxy-phenoxy)-3,5-diiodophenylalanine|L-3,5,3'-triiodothyronine|L-triiodothyronine|T3|3,5,3'-triiodothyronine}}
+
−
{{#set: consumed by=RXN-10607|RXN-10615|RXN-10609}}
+
−
{{#set: produced by=THYROXINE-DEIODINASE-RXN}}
+

Latest revision as of 19:22, 21 March 2018

Reaction RXN-113

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-102, gibberellin inactivation I (2β-hydroxylation): PWY-102
    • 4 reactions found over 11 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-113&oldid=41215"