Difference between revisions of "THRDLCTCAT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inch...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=THRDLCTCAT-PWY THRDLCTCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=THRDLCTCAT-PWY THRDLCTCAT-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-threonine degradation III (to methylglyoxal) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''3''' reactions found over '''3''' reactions in the full pathway |
| − | * | + | * [[AMACETOXID-RXN]] |
| − | * [[ | + | ** 2 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_8756]] |
| − | * | + | *** [[Tiso_gene_18325]] |
| − | + | ** 3 reconstruction source(s) associated: | |
| − | * [[ | + | *** [[orthology-athaliana]] |
| − | * [[ | + | *** [[orthology-creinhardtii]] |
| − | * [[ | + | *** [[orthology-esiliculosus]] |
| − | * [[ | + | * [[THREODEHYD-RXN]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_1301]] |
| − | * [[ | + | ** 1 reconstruction source(s) associated: |
| − | * [[ | + | *** [[annotation-experimental_annotation]] |
| − | == Reaction(s) | + | * [[THREOSPON-RXN]] |
| − | + | ** 0 associated gene: | |
| − | + | ** 1 reconstruction source(s) associated: | |
| + | *** [[annotation-experimental_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=THRDLCTCAT-PWY THRDLCTCAT-PWY] | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | ** [http:// | + | {{#set: common name=L-threonine degradation III (to methylglyoxal)}} |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:22, 21 March 2018
Pathway THRDLCTCAT-PWY
- taxonomic range:
- common name:
- L-threonine degradation III (to methylglyoxal)
- Synonym(s):
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- AMACETOXID-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- THREODEHYD-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- THREOSPON-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
