Difference between revisions of "Tiso gene 4990"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_4990 == * right end position: ** 2693 * transcription direction: ** POSITIVE * left end position: ** 742 * centisome position: ** 5.2796354...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] ==
+
== Gene Tiso_gene_4990 ==
−
* smiles:
+
* right end position:
−
** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
+
** 2693
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** myricetin
+
** 742
−
* molecular weight:
+
* centisome position:
−
** 317.231    
+
** 5.2796354    
 
* Synonym(s):
 
* Synonym(s):
−
** myricitin
 
−
** cannabiscetin
 
−
** myricetol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CATAL-RXN]]
−
* [[RXN-8450]]
+
** Source: [[orthology-synechocystis]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[CYTOCHROME-C-PEROXIDASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5506]]
 +
* [[DETOX1-PWY]]
 +
* [[DETOX1-PWY-1]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2693}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=742}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395]
+
{{#set: centisome position=5.2796354   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=CATAL-RXN|CYTOCHROME-C-PEROXIDASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107]
+
{{#set: pathway associated=PWY-5506|DETOX1-PWY|DETOX1-PWY-1}}
−
* HMDB : HMDB02755
+
−
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}}
+
−
{{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}}
+
−
{{#set: common name=myricetin}}
+
−
{{#set: molecular weight=317.231   }}
+
−
{{#set: common name=myricitin|cannabiscetin|myricetol}}
+
−
{{#set: produced by=RXN-8450}}
+

Latest revision as of 19:23, 21 March 2018

Gene Tiso_gene_4990

  • right end position:
    • 2693
  • transcription direction:
    • POSITIVE
  • left end position:
    • 742
  • centisome position:
    • 5.2796354
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4990&oldid=41239"