Difference between revisions of "Tiso gene 15744"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == * smiles: ** CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O...")
(Created page with "Category:Gene == Gene Tiso_gene_15744 == * right end position: ** 4823 * transcription direction: ** POSITIVE * left end position: ** 725 * centisome position: ** 15.02279...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] ==
+
== Gene Tiso_gene_15744 ==
−
* smiles:
+
* right end position:
−
** CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)
+
** 4823
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** red chlorophyll catabolite
+
** 725
−
* molecular weight:
+
* centisome position:
−
** 624.692    
+
** 15.022794    
 
* Synonym(s):
 
* Synonym(s):
−
** RCC
 
−
** red bilin
 
−
** (7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7741]]
+
* Reaction: [[ADENYLATECYC-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4823}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820276 91820276]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=725}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58716 58716]
+
{{#set: centisome position=15.022794   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ADENYLATECYC-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C18022 C18022]
+
−
{{#set: smiles=CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)}}
+
−
{{#set: inchi key=InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M}}
+
−
{{#set: common name=red chlorophyll catabolite}}
+
−
{{#set: molecular weight=624.692   }}
+
−
{{#set: common name=RCC|red bilin|(7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione}}
+
−
{{#set: consumed by=RXN-7741}}
+

Latest revision as of 20:23, 21 March 2018

Gene Tiso_gene_15744

  • right end position:
    • 4823
  • transcription direction:
    • POSITIVE
  • left end position:
    • 725
  • centisome position:
    • 15.022794
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15744&oldid=41253"