Difference between revisions of "MYRICETIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7338 PWY-7338] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
 
* common name:
 
* common name:
** 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast)
+
** myricetin
 +
* inchi key:
 +
** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 317.231   
 
* Synonym(s):
 
* Synonym(s):
 +
** myricitin
 +
** cannabiscetin
 +
** myricetol
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''12''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[RXN-14785]]
+
* [[RXN-8450]]
* [[RXN-14788]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-14789]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14777 RXN-14777]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14778 RXN-14778]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14779 RXN-14779]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14780 RXN-14780]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14781 RXN-14781]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14784 RXN-14784]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14786 RXN-14786]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14787 RXN-14787]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14790 RXN-14790]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
{{#set: common name=10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643]
{{#set: reaction found=3}}
+
* HMDB : HMDB02755
{{#set: reaction not found=12}}
+
* CHEBI:
{{#set: completion rate=25.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107]
 +
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}}
 +
{{#set: common name=myricetin}}
 +
{{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=317.231    }}
 +
{{#set: common name=myricitin|cannabiscetin|myricetol}}
 +
{{#set: produced by=RXN-8450}}

Latest revision as of 19:23, 21 March 2018

Metabolite MYRICETIN

  • smiles:
    • C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
  • common name:
    • myricetin
  • inchi key:
    • InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
  • molecular weight:
    • 317.231
  • Synonym(s):
    • myricitin
    • cannabiscetin
    • myricetol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))" cannot be used as a page name in this wiki.