Difference between revisions of "Tiso gene 4472"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18493 CPD-18493] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)...")
(Created page with "Category:Gene == Gene Tiso_gene_4472 == * right end position: ** 13681 * transcription direction: ** POSITIVE * left end position: ** 11910 * centisome position: ** 80.451...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18493 CPD-18493] ==
+
== Gene Tiso_gene_4472 ==
−
* smiles:
+
* right end position:
−
** CCCCCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 13681
−
* common name:
+
* transcription direction:
−
** (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=NNEPPYNERZEJEE-VUGYPBMHSA-J
+
** 11910
−
* molecular weight:
+
* centisome position:
−
** 1120.05    
+
** 80.45123    
 
* Synonym(s):
 
* Synonym(s):
−
** (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17115]]
+
* Reaction: [[DTDPDEHYRHAMREDUCT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[DTDPRHAMSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=13681}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193738 72193738]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=11910}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76366 76366]
+
{{#set: centisome position=80.45123   }}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=DTDPDEHYRHAMREDUCT-RXN}}
−
{{#set: common name=(3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
+
{{#set: pathway associated=DTDPRHAMSYN-PWY}}
−
{{#set: inchi key=InChIKey=NNEPPYNERZEJEE-VUGYPBMHSA-J}}
+
−
{{#set: molecular weight=1120.05   }}
+
−
{{#set: common name=(3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-17115}}
+

Latest revision as of 20:23, 21 March 2018

Gene Tiso_gene_4472

  • right end position:
    • 13681
  • transcription direction:
    • POSITIVE
  • left end position:
    • 11910
  • centisome position:
    • 80.45123
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4472&oldid=41284"