Difference between revisions of "Trans-D2-cis-cis-D15-33-C52-3-ACPs"

Latest revision as of 20:23, 21 March 2018

"a trans-delta2-cis,cis-delta15,33-C52:3-[acp" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D15-33-C52-3-ACPs trans-D2-cis-cis-D15-33-C52-3-ACPs] ==
-* smiles:
-** CSCCCCCC(=O)C([O-])=O
 * common name:
-** 7-(methylthio)-2-oxoheptanoate
+** a trans-delta2-cis,cis-delta15,33-C52:3-[acp]
-* inchi key:
-** InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M
-* molecular weight:
-** 189.249
 * Synonym(s):
-** 7-(methylthio)-2-oxoheptanoic acid
 == Reaction(s) known to consume the compound ==
+* [[RXN1G-1325]]
 == Reaction(s) known to produce the compound ==
-* [[RXNQT-4168]]
-* [[RXN-18207]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a trans-delta2-cis,cis-delta15,33-C52:3-[acp]}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237184 44237184]
+{{#set: consumed by=RXN1G-1325}}
-* KNAPSACK : C00007645
-{{#set: smiles=CSCCCCCC(=O)C([O-])=O}}
-{{#set: common name=7-(methylthio)-2-oxoheptanoate}}
-{{#set: inchi key=InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M}}
-{{#set: molecular weight=189.249    }}
-{{#set: common name=7-(methylthio)-2-oxoheptanoic acid}}
-{{#set: produced by=RXNQT-4168|RXN-18207}}