Difference between revisions of "CYSTINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] == * smiles: ** CSCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=TWAIOPPFLZEXC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * common name: ** L-cys...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-cystine |
| + | * inchi key: | ||
| + | ** InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 240.292 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15128]] | ||
| + | * [[CYSTHIOCYS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 24645-67-8 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992103 6992103] |
| − | * | + | * HMDB : HMDB00192 |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01420 C01420] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35491 35491] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC35491 |
| − | + | {{#set: smiles=C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+]}} | |
| + | {{#set: common name=L-cystine}} | ||
| + | {{#set: inchi key=InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N}} | ||
| + | {{#set: molecular weight=240.292 }} | ||
| + | {{#set: consumed by=RXN-15128|CYSTHIOCYS-RXN}} | ||
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite CYSTINE
- smiles:
- C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+]
- common name:
- L-cystine
- inchi key:
- InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N
- molecular weight:
- 240.292
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 24645-67-8
- PUBCHEM:
- HMDB : HMDB00192
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC35491
"C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+" cannot be used as a page name in this wiki.
