Difference between revisions of "CPD-10139"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11663 == * Synonym(s): == Reactions associated == * GLUTAMATE-N-ACETYLTRANSFERASE-RXN ** pantograph-athaliana ** [[pantograph]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == * smiles: ** C=C(C1(CCC2(C(C1)O2)(C)))C * common name: ** (+)-(1S,4R)-l...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == |
| + | * smiles: | ||
| + | ** C=C(C1(CCC2(C(C1)O2)(C)))C | ||
| + | * common name: | ||
| + | ** (+)-(1S,4R)-limonene-1,2- epoxide | ||
| + | * inchi key: | ||
| + | ** InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N | ||
| + | * molecular weight: | ||
| + | ** 152.236 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-9464]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12382524 12382524] |
| + | * HMDB : HMDB35158 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C07271 C07271] | ||
| + | {{#set: smiles=C=C(C1(CCC2(C(C1)O2)(C)))C}} | ||
| + | {{#set: common name=(+)-(1S,4R)-limonene-1,2- epoxide}} | ||
| + | {{#set: inchi key=InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N}} | ||
| + | {{#set: molecular weight=152.236 }} | ||
| + | {{#set: reversible reaction associated=RXN-9464}} | ||
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite CPD-10139
- smiles:
- C=C(C1(CCC2(C(C1)O2)(C)))C
- common name:
- (+)-(1S,4R)-limonene-1,2- epoxide
- inchi key:
- InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N
- molecular weight:
- 152.236
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
