Difference between revisions of "CPD-11752"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-428 PWY66-428] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11752 CPD-11752] == * smiles: ** COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11752 CPD-11752] == |
| − | * | + | * smiles: |
| − | ** | + | ** COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl))) |
* common name: | * common name: | ||
| − | ** | + | ** rebeccamycin |
| + | * inchi key: | ||
| + | ** InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N | ||
| + | * molecular weight: | ||
| + | ** 570.385 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10847]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19701 C19701] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.65891.html 65891] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=135511 135511] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=73110 73110] | ||
| + | {{#set: smiles=COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl)))}} | ||
| + | {{#set: common name=rebeccamycin}} | ||
| + | {{#set: inchi key=InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N}} | ||
| + | {{#set: molecular weight=570.385 }} | ||
| + | {{#set: produced by=RXN-10847}} | ||
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite CPD-11752
- smiles:
- COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl)))
- common name:
- rebeccamycin
- inchi key:
- InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N
- molecular weight:
- 570.385
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
