Difference between revisions of "RXN-9538"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA ACETYL-COA] == * smiles: ** CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9538 RXN-9538] == * direction: ** LEFT-TO-RIGHT * common name: ** trans tetradec-2-enoyl-[acyl-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA ACETYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9538 RXN-9538] ==
−
* smiles:
+
* direction:
−
** CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZSLZBFCDCINBPY-ZSJPKINUSA-J
+
 
* common name:
 
* common name:
−
** acetyl-CoA
+
** trans tetradec-2-enoyl-[acyl-carrier-protein] reductase (NADPH, B-specific)
−
* molecular weight:
+
** polyketide_synthase
−
** 805.54   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.10 EC-1.3.1.10]
 +
** [http://enzyme.expasy.org/EC/1.3.1.39 EC-1.3.1.39]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 
* Synonym(s):
 
* Synonym(s):
−
** acetyl coenzyme-A
+
** trans tetradec-2-enoyl-[ACP] reductase
−
** ac-CoA
+
−
** acetylcoenzyme-A
+
−
** acetyl-S-CoA
+
−
** ac-S-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+
* With identifiers:
−
* [[2.3.1.118-RXN]]
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Tetradec-2-enoyl-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[Myristoyl-ACPs]][c]
−
* [[IPMS]]
+
* With common name(s):
−
* [[RXN-9192]]
+
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a trans tetradec-2-enoyl-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a myristoyl-[acp][c]
−
* [[ACDHi]]
+
 
−
* [[RXN0-1133]]
+
== Genes associated with this reaction  ==
−
* [[2.3.1.165-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN-17864]]
+
* Gene: [[Tiso_gene_13394]]
−
* [[2.3.1.180-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-12565]]
+
*** Assignment: EC-NUMBER
−
* [[RXN-17860]]
+
* Gene: [[Tiso_gene_10778]]
−
* [[RXN-17861]]
+
** Source: [[orthology-synechocystis]]
−
* [[RXN-17862]]
+
* Gene: [[Tiso_gene_10876]]
−
* [[RXN-17863]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[2-ISOPROPYLMALATESYN-RXN]]
+
*** Assignment: EC-NUMBER
−
* [[RXN0-5055]]
+
* Gene: [[Tiso_gene_135]]
−
* [[RXN-17850]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-7743]]
+
*** Assignment: EC-NUMBER
−
* [[DIHYDLIPACETRANS-RXN]]
+
* Gene: [[Tiso_gene_136]]
−
* [[FATTY-ACYL-COA-SYNTHASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[ACACT7m]]
+
*** Assignment: EC-NUMBER
−
* [[ACDHmi]]
+
* Gene: [[Tiso_gene_500]]
−
* [[ACACT]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[CITSYN-RXN]]
+
*** Assignment: EC-NUMBER
−
* [[MALSYN-RXN]]
+
== Pathways  ==
−
* [[RXN-12362]]
+
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
−
* [[RXN-12363]]
+
** '''31''' reactions found over '''31''' reactions in the full pathway
−
* [[RXN-16017]]
+
== Reconstruction information  ==
−
* [[CSm]]
+
* Category: [[orthology]]
−
* [[ARYLAMINE-N-ACETYLTRANSFERASE-RXN]]
+
** Source: [[orthology-synechocystis]]
−
* [[RXN0-6948]]
+
*** Tool: [[pantograph]]
−
* [[GLUCOSAMINEPNACETYLTRANS-RXN]]
+
* Category: [[manual]]
−
* [[RXN-17855]]
+
** Source: [[manual-primary_network]]
−
* [[RXN-17854]]
+
* Category: [[annotation]]
−
* [[RXN-17857]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-17856]]
+
*** Tool: [[pathwaytools]]
−
* [[RXN-17851]]
+
−
* [[CSx]]
+
−
* [[RXN-17853]]
+
−
* [[RXN-17852]]
+
−
* [[RXN-17859]]
+
−
* [[RXN-17858]]
+
−
* [[RXN-13431]]
+
−
* [[SERINE-O-ACETTRAN-RXN]]
+
−
== Reaction(s) known to produce the compound ==
+
−
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
+
−
* [[RXN-17116]]
+
−
* [[RXN-14268]]
+
−
* [[RXN-16561]]
+
−
* [[RXN-2006]]
+
−
* [[RXN-17791]]
+
−
* [[RXN-11921]]
+
−
* [[RXN-17799]]
+
−
* [[RXN-13617]]
+
−
* [[ACETATE--COA-LIGASE-RXN]]
+
−
* [[RXN-10699]]
+
−
* [[PYRUVDEH-RXN]]
+
−
* [[RXN-12710]]
+
−
* [[RXN-17778]]
+
−
* [[RXN-14793]]
+
−
* [[2.3.1.155-RXN]]
+
−
* [[ACCAT]]
+
−
* [[RXN-14799]]
+
−
* [[RXN-14394]]
+
−
* [[RXN-14774]]
+
−
* [[RXN-17787]]
+
−
* [[RXN-17782]]
+
−
* [[RXN-14803]]
+
−
* [[AKBLIG-RXN]]
+
−
* [[RXN-16137]]
+
−
* [[RXN-2902]]
+
−
* [[RXN-11917]]
+
−
* [[RXN-10700]]
+
−
* [[RXN-10701]]
+
−
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
+
−
* [[RXN-14788]]
+
−
* [[RXN-17795]]
+
−
* [[KETOACYLCOATHIOL-RXN]]
+
−
* [[RXN-11246]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[TUBULIN-N-ACETYLTRANSFERASE-RXN]]
+
−
* [[ALCOHOL-O-ACETYLTRANSFERASE-RXN]]
+
−
* [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]]
+
−
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
+
−
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
+
−
* [[RXN-12561]]
+
−
* [[RXN-13871]]
+
−
* [[METHYLACETOACETYLCOATHIOL-RXN]]
+
−
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
+
−
* [[RXN-14274]]
+
−
* [[RXN-14277]]
+
−
* [[ACCOAth]]
+
−
* [[RXN-8032]]
+
−
* [[ACACT6]]
+
−
* [[ACACT7]]
+
−
* [[ACACT4]]
+
−
* [[ACCOAtm]]
+
−
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
+
−
* [[ACCOAtx]]
+
−
* [[RXN-13870]]
+
−
* [[N-ACETYLTRANSFER-RXN]]
+
−
* [[ACP-S-ACETYLTRANSFER-RXN]]
+
−
* [[ACETALD-DEHYDROG-RXN]]
+
 
== External links  ==
 
== External links  ==
−
* UM-BBD-CPD : c0031
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CAS : 72-89-9
+
{{#set: common name=trans tetradec-2-enoyl-[acyl-carrier-protein] reductase (NADPH, B-specific)}}
−
* METABOLIGHTS : MTBLC57288
+
{{#set: common name=polyketide_synthase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.3.1.10}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266541 45266541]
+
{{#set: ec number=EC-1.3.1.39}}
−
* KNAPSACK : C00007259
+
{{#set: ec number=EC-2.3.1.85}}
−
* HMDB : HMDB01206
+
{{#set: ec number=EC-2.3.1.86}}
−
* LIGAND-CPD:
+
{{#set: common name=trans tetradec-2-enoyl-[ACP] reductase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00024 C00024]
+
{{#set: gene associated=Tiso_gene_13394|Tiso_gene_10778|Tiso_gene_10876|Tiso_gene_135|Tiso_gene_136|Tiso_gene_500}}
−
* CHEBI:
+
{{#set: in pathway=PWY-5994}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57288 57288]
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
* BIGG : accoa
+
{{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation|orthology-synechocystis}}
−
{{#set: smiles=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: inchi key=InChIKey=ZSLZBFCDCINBPY-ZSJPKINUSA-J}}
+
−
{{#set: common name=acetyl-CoA}}
+
−
{{#set: molecular weight=805.54    }}
+
−
{{#set: common name=acetyl coenzyme-A|ac-CoA|acetylcoenzyme-A|acetyl-S-CoA|ac-S-CoA}}
+
−
{{#set: consumed by=ACETYL-COA-CARBOXYLTRANSFER-RXN|2.3.1.118-RXN|IPMS|RXN-9192|ACDHi|RXN0-1133|2.3.1.165-RXN|RXN-17864|2.3.1.180-RXN|RXN-12565|RXN-17860|RXN-17861|RXN-17862|RXN-17863|2-ISOPROPYLMALATESYN-RXN|RXN0-5055|RXN-17850|RXN-7743|DIHYDLIPACETRANS-RXN|FATTY-ACYL-COA-SYNTHASE-RXN|ACACT7m|ACDHmi|ACACT|CITSYN-RXN|MALSYN-RXN|RXN-12362|RXN-12363|RXN-16017|CSm|ARYLAMINE-N-ACETYLTRANSFERASE-RXN|RXN0-6948|GLUCOSAMINEPNACETYLTRANS-RXN|RXN-17855|RXN-17854|RXN-17857|RXN-17856|RXN-17851|CSx|RXN-17853|RXN-17852|RXN-17859|RXN-17858|RXN-13431|SERINE-O-ACETTRAN-RXN}}
+
−
{{#set: produced by=HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN|RXN-17116|RXN-14268|RXN-16561|RXN-2006|RXN-17791|RXN-11921|RXN-17799|RXN-13617|ACETATE--COA-LIGASE-RXN|RXN-10699|PYRUVDEH-RXN|RXN-12710|RXN-17778|RXN-14793|2.3.1.155-RXN|ACCAT|RXN-14799|RXN-14394|RXN-14774|RXN-17787|RXN-17782|RXN-14803|AKBLIG-RXN|RXN-16137|RXN-2902|RXN-11917|RXN-10700|RXN-10701|MALONYL-COA-DECARBOXYLASE-RXN|RXN-14788|RXN-17795|KETOACYLCOATHIOL-RXN|RXN-11246}}
+
−
{{#set: reversible reaction associated=TUBULIN-N-ACETYLTRANSFERASE-RXN|ALCOHOL-O-ACETYLTRANSFERASE-RXN|ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.|HOMOSERINE-O-ACETYLTRANSFERASE-RXN|HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN|RXN-12561|RXN-13871|METHYLACETOACETYLCOATHIOL-RXN|HISTONE-ACETYLTRANSFERASE-RXN|RXN-14274|RXN-14277|ACCOAth|RXN-8032|ACACT6|ACACT7|ACACT4|ACCOAtm|ACETYL-COA-ACETYLTRANSFER-RXN|ACCOAtx|RXN-13870|N-ACETYLTRANSFER-RXN|ACP-S-ACETYLTRANSFER-RXN|ACETALD-DEHYDROG-RXN}}
+

Latest revision as of 19:23, 21 March 2018

Reaction RXN-9538

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans tetradec-2-enoyl-[acyl-carrier-protein] reductase (NADPH, B-specific)
    • polyketide_synthase
  • ec number:
  • Synonym(s):
    • trans tetradec-2-enoyl-[ACP] reductase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"trans tetradec-2-enoyl-[acyl-carrier-protein] reductase (NADPH, B-specific)" cannot be used as a page name in this wiki.



"trans tetradec-2-enoyl-[ACP] reductase" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9538&oldid=41339"