Difference between revisions of "RXN-14271"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == * smiles: ** C=C(C1(CCC2(C(C1)O2)(C)))C * inchi key: ** InChIKey=CCEFMU...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14271 RXN-14271] == * direction: ** LEFT-TO-RIGHT * common name: ** (S)-3-hydroxypalmitoyl-CoA...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14271 RXN-14271] ==
−
* smiles:
+
* direction:
−
** C=C(C1(CCC2(C(C1)O2)(C)))C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N
+
 
* common name:
 
* common name:
−
** (+)-(1S,4R)-limonene-1,2- epoxide
+
** (S)-3-hydroxypalmitoyl-CoA oxidoreductase
−
* molecular weight:
+
* ec number:
−
** 152.236   
+
** [http://enzyme.expasy.org/EC/1.1.1.211 EC-1.1.1.211]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPD0-2232]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-OXOPALMITOYL-COA]][c]
−
* [[RXN-9464]]
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 (S)-3-hydroxyhexadecanoyl-CoA[c] '''=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 3-oxo-palmitoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5857]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_14262]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
 +
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
* [[PWY-7656]], Spodoptera littoralis pheromone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7656 PWY-7656]
 +
** '''6''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12382524 12382524]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31160 31160]
−
* LIGAND-CPD:
+
* LIGAND-RXN:
−
** [http://www.genome.jp/dbget-bin/www_bget?C07271 C07271]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04737 R04737]
−
* HMDB : HMDB35158
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: smiles=C=C(C1(CCC2(C(C1)O2)(C)))C}}
+
{{#set: common name=(S)-3-hydroxypalmitoyl-CoA oxidoreductase}}
−
{{#set: inchi key=InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N}}
+
{{#set: ec number=EC-1.1.1.211}}
−
{{#set: common name=(+)-(1S,4R)-limonene-1,2- epoxide}}
+
{{#set: gene associated=Tiso_gene_5857|Tiso_gene_14262}}
−
{{#set: molecular weight=152.236    }}
+
{{#set: in pathway=PWY-7654|PWY-7656}}
−
{{#set: reversible reaction associated=RXN-9464}}
+
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=orthology-creinhardtii|annotation-experimental_annotation|annotation-in-silico_annotation|orthology-athaliana|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:24, 21 March 2018

Reaction RXN-14271

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • (S)-3-hydroxypalmitoyl-CoA oxidoreductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 (S)-3-hydroxyhexadecanoyl-CoA[c] => 1 NADH[c] + 1 H+[c] + 1 3-oxo-palmitoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7654, (8E,10E)-dodeca-8,10-dienol biosynthesis: PWY-7654
    • 6 reactions found over 11 reactions in the full pathway
  • PWY-7656, Spodoptera littoralis pheromone biosynthesis: PWY-7656
    • 6 reactions found over 22 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14271&oldid=41361"