Difference between revisions of "CPD-3483"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * common name: ** hy...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7199 PWY-7199] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-554915 TAX-554915]
+
** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
 
* common name:
 
* common name:
** pyrimidine deoxyribonucleosides salvage
+
** hydroxybupropion
 +
* inchi key:
 +
** InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
 +
* molecular weight:
 +
** 256.752   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[THYMIDYLATESYN-RXN]]
+
* [[RXN66-181]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* [http://metacyc.org/META/NEW-IMAGE?object=CYTIDEAM-RXN CYTIDEAM-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=DEOXYCYTIDINE-KINASE-RXN DEOXYCYTIDINE-KINASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=DURIDKI-RXN DURIDKI-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=THYKI-RXN THYKI-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-554915}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-33208}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202442 25202442]
{{#set: taxonomic range=TAX-33090}}
+
* HMDB : HMDB12235
{{#set: taxonomic range=TAX-2}}
+
{{#set: smiles=CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)}}
{{#set: taxonomic range=TAX-2157}}
+
{{#set: common name=hydroxybupropion}}
{{#set: common name=pyrimidine deoxyribonucleosides salvage}}
+
{{#set: inchi key=InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O}}
{{#set: reaction found=1}}
+
{{#set: molecular weight=256.752    }}
{{#set: reaction not found=5}}
+
{{#set: produced by=RXN66-181}}
{{#set: completion rate=20.0}}
+

Latest revision as of 20:24, 21 March 2018

Metabolite CPD-3483

  • smiles:
    • CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
  • common name:
    • hydroxybupropion
  • inchi key:
    • InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
  • molecular weight:
    • 256.752
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)" cannot be used as a page name in this wiki.