|
|
(3 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Metabolite]] | + | [[Category:Pathway]] |
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PUTDEG-PWY PUTDEG-PWY] == |
− | * smiles: | + | * taxonomic range: |
− | ** CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * inchi key:
| + | |
− | ** InChIKey=LCCNCVORNKJIRZ-UHFFFAOYSA-N
| + | |
| * common name: | | * common name: |
− | ** parathion | + | ** putrescine degradation I |
− | * molecular weight:
| + | |
− | ** 291.258
| + | |
| * Synonym(s): | | * Synonym(s): |
− | ** ethyl parathion | + | ** putrescine degradation |
− | ** parthion
| + | |
− | ** alkron
| + | |
− | ** Paraphos
| + | |
− | ** Foliclal
| + | |
− | ** Fosferno
| + | |
− | ** Fostox
| + | |
− | ** Rhodiatox
| + | |
− | ** O,O-diethyl O-p-nitrophenyl phosphorothioate
| + | |
− | ** diethyl-p-nitrophenyl monothiophosphate
| + | |
− | ** DNTP
| + | |
− | ** Alleron
| + | |
− | ** Aphamite
| + | |
− | ** Etilon
| + | |
− | ** Folidol
| + | |
− | ** Phoskil
| + | |
− | ** Parathion-E
| + | |
− | ** Aqua 9-Parathion
| + | |
− | ** Bladen
| + | |
− | ** phosphorothioic acid O,O-diethyl-O-(4-nitrophenyl) ester
| + | |
− | ** diethyl p-nitrophenyl thiophosphate
| + | |
− | ** O,O-diethyl-O-(p-nitrophenyl)thionophosphate
| + | |
− | ** diethylparathion
| + | |
− | ** p-nitrophenol O-ester with O,O-diethylphosphorothioate
| + | |
− | ** AATP
| + | |
− | ** acc 3422
| + | |
− | ** american cyanamid 3422
| + | |
− | ** Aralo
| + | |
− | ** bayer e-605
| + | |
− | ** bladan f
| + | |
− | ** corothion
| + | |
− | ** corthione
| + | |
− | ** danthion
| + | |
− | ** ecatox
| + | |
− | ** fosfive
| + | |
− | ** fosova
| + | |
− | ** fostern
| + | |
− | ** genithion
| + | |
− | ** kolphos
| + | |
− | ** kypthion
| + | |
− | ** lirothion
| + | |
− | ** murfos
| + | |
− | ** nitrostygmine
| + | |
− | ** niuif-100
| + | |
− | ** nourithion
| + | |
− | ** oleofos 20
| + | |
− | ** oleoparathion
| + | |
− | ** Orthophos
| + | |
− | ** panthion
| + | |
− | ** Paramar
| + | |
− | ** paramar 50
| + | |
− | ** parathene
| + | |
− | ** Parawet
| + | |
− | ** pestox plus
| + | |
− | ** pethion
| + | |
− | ** phosphemol
| + | |
− | ** phosphenol
| + | |
− | ** phosphostigmine
| + | |
− | ** stathion
| + | |
− | ** strathion
| + | |
− | ** sulfos
| + | |
− | ** thiophos 3422
| + | |
− | ** vapophos
| + | |
− | ** diethyl para-nitrophenol thiophosphate
| + | |
− | ** diethyl 4-nitrophenyl phosphorothionate
| + | |
− | ** diethyl p-nitrophenyl thionophosphate
| + | |
− | ** drexel parathion 8E
| + | |
− | ** E 605 F
| + | |
− | ** e 605 forte
| + | |
− | ** ekatox
| + | |
− | ** ethlon
| + | |
− | ** folidol e605
| + | |
− | ** folidol oil
| + | |
− | ** fosfermo
| + | |
− | ** fosfex
| + | |
− | ** gearphos
| + | |
− | ** lethalaire g-54
| + | |
− | ** oleoparaphene
| + | |
− | ** Paradust
| + | |
− | ** rhodiasol
| + | |
− | ** rhodiatrox
| + | |
− | ** selephos
| + | |
− | ** soprathion
| + | |
− | ** super rodiatox
| + | |
− | ** vitrex
| + | |
− | ** penncap e
| + | |
− | ** thiomex
| + | |
− | ** tiofos
| + | |
− | ** Viran
| + | |
− | ** Durathion
| + | |
− | ** Thionspray No.84
| + | |
− | ** Bladan
| + | |
− | ** Diethyl O-p-nitrophenyl phosphorothioate
| + | |
− | ** Fosferno 50
| + | |
− | ** Niran
| + | |
− | ** Ethyl parathion (O,O-diethyl-O-p-nitrophenylthiophosphate)
| + | |
| | | |
− | == Reaction(s) known to consume the compound == | + | == Reaction(s) found == |
− | * [[ARYLDIALKYL-PHOSPHATASE-RXN]] | + | '''1''' reactions found over '''2''' reactions in the full pathway |
− | == Reaction(s) known to produce the compound ==
| + | * [[AMINOBUTDEHYDROG-RXN]] |
− | == Reaction(s) of unknown directionality == | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_17322]] |
| + | ** 1 reconstruction source(s) associated: |
| + | *** [[annotation-in-silico_annotation]] |
| + | == Reaction(s) not found == |
| + | * [http://metacyc.org/META/NEW-IMAGE?object=PUTTRANSAM-RXN PUTTRANSAM-RXN] |
| == External links == | | == External links == |
− | * CAS : 56-38-2 | + | * ECOCYC: |
− | * PUBCHEM:
| + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PUTDEG-PWY PUTDEG-PWY] |
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=991 991] | + | {{#set: taxonomic range=TAX-2}} |
− | * HMDB : HMDB01355
| + | {{#set: common name=putrescine degradation I}} |
− | * LIGAND-CPD:
| + | {{#set: common name=putrescine degradation}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?C06604 C06604]
| + | {{#set: reaction found=1}} |
− | * CHEMSPIDER:
| + | {{#set: total reaction=2}} |
− | ** [http://www.chemspider.com/Chemical-Structure.13844817.html 13844817]
| + | {{#set: completion rate=50.0}} |
− | * CHEBI:
| + | |
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27928 27928]
| + | |
− | {{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S}} | + | |
− | {{#set: inchi key=InChIKey=LCCNCVORNKJIRZ-UHFFFAOYSA-N}} | + | |
− | {{#set: common name=parathion}} | + | |
− | {{#set: molecular weight=291.258 }} | + | |
− | {{#set: common name=ethyl parathion|parthion|alkron|Paraphos|Foliclal|Fosferno|Fostox|Rhodiatox|O,O-diethyl O-p-nitrophenyl phosphorothioate|diethyl-p-nitrophenyl monothiophosphate|DNTP|Alleron|Aphamite|Etilon|Folidol|Phoskil|Parathion-E|Aqua 9-Parathion|Bladen|phosphorothioic acid O,O-diethyl-O-(4-nitrophenyl) ester|diethyl p-nitrophenyl thiophosphate|O,O-diethyl-O-(p-nitrophenyl)thionophosphate|diethylparathion|p-nitrophenol O-ester with O,O-diethylphosphorothioate|AATP|acc 3422|american cyanamid 3422|Aralo|bayer e-605|bladan f|corothion|corthione|danthion|ecatox|fosfive|fosova|fostern|genithion|kolphos|kypthion|lirothion|murfos|nitrostygmine|niuif-100|nourithion|oleofos 20|oleoparathion|Orthophos|panthion|Paramar|paramar 50|parathene|Parawet|pestox plus|pethion|phosphemol|phosphenol|phosphostigmine|stathion|strathion|sulfos|thiophos 3422|vapophos|diethyl para-nitrophenol thiophosphate|diethyl 4-nitrophenyl phosphorothionate|diethyl p-nitrophenyl thionophosphate|drexel parathion 8E|E 605 F|e 605 forte|ekatox|ethlon|folidol e605|folidol oil|fosfermo|fosfex|gearphos|lethalaire g-54|oleoparaphene|Paradust|rhodiasol|rhodiatrox|selephos|soprathion|super rodiatox|vitrex|penncap e|thiomex|tiofos|Viran|Durathion|Thionspray No.84|Bladan|Diethyl O-p-nitrophenyl phosphorothioate|Fosferno 50|Niran|Ethyl parathion (O,O-diethyl-O-p-nitrophenylthiophosphate)}} | + | |
− | {{#set: consumed by=ARYLDIALKYL-PHOSPHATASE-RXN}} | + | |