Difference between revisions of "N-Ac-L-methionyl-L-asparaginyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == * smiles: ** C=C(C1(CCC2(C(C1)O2)(C)))C * inchi key: ** InChIKey=CCEFMU...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Ac-L-methionyl-L-asparaginyl-Protein N-Ac-L-methionyl-L-asparaginyl-Protein] == * common name...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Ac-L-methionyl-L-asparaginyl-Protein N-Ac-L-methionyl-L-asparaginyl-Protein] ==
−
* smiles:
+
−
** C=C(C1(CCC2(C(C1)O2)(C)))C
+
−
* inchi key:
+
−
** InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N
+
 
* common name:
 
* common name:
−
** (+)-(1S,4R)-limonene-1,2- epoxide
+
** an N-terminal-Nα-acetyl-L-methionyl-L-asparaginyl-[protein]
−
* molecular weight:
+
−
** 152.236   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** an Nα-acetyl-L-methionyl-L-asparaginyl-[protein]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17892]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17850]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-9464]]
 
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an N-terminal-Nα-acetyl-L-methionyl-L-asparaginyl-[protein]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12382524 12382524]
+
{{#set: common name=an Nα-acetyl-L-methionyl-L-asparaginyl-[protein]}}
−
* LIGAND-CPD:
+
{{#set: consumed by=RXN-17892}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C07271 C07271]
+
{{#set: produced by=RXN-17850}}
−
* HMDB : HMDB35158
+
−
{{#set: smiles=C=C(C1(CCC2(C(C1)O2)(C)))C}}
+
−
{{#set: inchi key=InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N}}
+
−
{{#set: common name=(+)-(1S,4R)-limonene-1,2- epoxide}}
+
−
{{#set: molecular weight=152.236    }}
+
−
{{#set: consumed or produced by=RXN-9464}}
+

Latest revision as of 20:24, 21 March 2018

Metabolite N-Ac-L-methionyl-L-asparaginyl-Protein

  • common name:
    • an N-terminal-Nα-acetyl-L-methionyl-L-asparaginyl-[protein]
  • Synonym(s):
    • an Nα-acetyl-L-methionyl-L-asparaginyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal-Nα-acetyl-L-methionyl-L-asparaginyl-[protein" cannot be used as a page name in this wiki.
"an Nα-acetyl-L-methionyl-L-asparaginyl-[protein" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-Ac-L-methionyl-L-asparaginyl-Protein&oldid=41385"