Difference between revisions of "ATCD"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-MANNOSAMINE-6P N-ACETYL-D-MANNOSAMINE-6P] == * smiles: ** CC(=O)NC1(C(O)OC(COP([O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCD ATCD] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:CDP phosphotransferase * Synonym(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-MANNOSAMINE-6P N-ACETYL-D-MANNOSAMINE-6P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCD ATCD] ==
* smiles:
+
* direction:
** CC(=O)NC1(C(O)OC(COP([O-])(=O)[O-])C(O)C(O)1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=BRGMHAYQAZFZDJ-ZTVVOAFPSA-L
+
 
* common name:
 
* common name:
** N-acetyl-D-mannosamine 6-phosphate
+
** ATP:CDP phosphotransferase
* molecular weight:
+
** 299.174   
+
 
* Synonym(s):
 
* Synonym(s):
** ManNAc-6-P
 
** N-acetylmannosamine-6-P
 
** N-acetyl-mannosamine-6-P
 
** N-acetyl-D-mannosamine-6-P
 
** N-acetyl-mannosamine 6-phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9988]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CDP]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[CTP]][c] '''+''' 1.0 [[ADP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 CDP[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 CTP[c] '''+''' 1.0 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16529]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_13128]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C04257 C04257]
+
{{#set: common name=ATP:CDP phosphotransferase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_16529|Tiso_gene_13128}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28273 28273]
+
{{#set: in pathway=}}
* BIGG : acmanap
+
{{#set: reconstruction category=orthology}}
* PUBCHEM:
+
{{#set: reconstruction source=orthology-creinhardtii}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54758653 54758653]
+
{{#set: reconstruction tool=pantograph}}
* HMDB : HMDB01121
+
{{#set: smiles=CC(=O)NC1(C(O)OC(COP([O-])(=O)[O-])C(O)C(O)1)}}
+
{{#set: inchi key=InChIKey=BRGMHAYQAZFZDJ-ZTVVOAFPSA-L}}
+
{{#set: common name=N-acetyl-D-mannosamine 6-phosphate}}
+
{{#set: molecular weight=299.174    }}
+
{{#set: common name=ManNAc-6-P|N-acetylmannosamine-6-P|N-acetyl-mannosamine-6-P|N-acetyl-D-mannosamine-6-P|N-acetyl-mannosamine 6-phosphate}}
+
{{#set: consumed by=RXN-9988}}
+

Latest revision as of 19:24, 21 March 2018

Reaction ATCD

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:CDP phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 CDP[c] + 1.0 ATP[c] => 1.0 CTP[c] + 1.0 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links