Difference between revisions of "CPD-11770"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10324 == * right end position: ** 2763 * transcription direction: ** POSITIVE * left end position: ** 1194 * centisome position: ** 13.8290...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) * common name: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) |
| − | * | + | * common name: |
| − | ** | + | ** 7,8-dihydromonapterin |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 255.233 |
* Synonym(s): | * Synonym(s): | ||
| + | ** DHM | ||
| + | ** H2-MPt | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | * [[RXN-10857]] |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C21008 C21008] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71175 71175] |
| − | {{#set: reaction associated= | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479435 45479435] | ||
| + | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))}} | ||
| + | {{#set: common name=7,8-dihydromonapterin}} | ||
| + | {{#set: inchi key=InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N}} | ||
| + | {{#set: molecular weight=255.233 }} | ||
| + | {{#set: common name=DHM|H2-MPt}} | ||
| + | {{#set: reversible reaction associated=RXN-10857}} | ||
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite CPD-11770
- smiles:
- C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))
- common name:
- 7,8-dihydromonapterin
- inchi key:
- InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N
- molecular weight:
- 255.233
- Synonym(s):
- DHM
- H2-MPt
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
