Difference between revisions of "RXN-15121"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15121 RXN-15121] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15121 RXN-15121] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[CPD-15056]][c] '''=>''' 1 [[CPD-16013]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 (2Z)-2-aminobut-2-enoate[c] '''=>''' 1 2-iminobutanoate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[HOMOCYSDEGR-PWY]], L-cysteine biosynthesis III (from L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[ILEUSYN-PWY]], L-isoleucine biosynthesis I (from threonine): [http://metacyc.org/META/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-5826]], hypoglycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826] | ||
+ | ** '''4''' reactions found over '''14''' reactions in the full pathway | ||
+ | * [[PWY-5437]], L-threonine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5437 PWY-5437] | ||
+ | ** '''3''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-701]], L-methionine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-701 PWY-701] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=HOMOCYSDEGR-PWY|ILEUSYN-PWY|PWY-5826|PWY-5437|PWY-701}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:24, 21 March 2018
Contents
Reaction RXN-15121
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 (2Z)-2-aminobut-2-enoate[c] => 1 2-iminobutanoate[c]
Genes associated with this reaction
Pathways
- HOMOCYSDEGR-PWY, L-cysteine biosynthesis III (from L-homocysteine): HOMOCYSDEGR-PWY
- 4 reactions found over 4 reactions in the full pathway
- ILEUSYN-PWY, L-isoleucine biosynthesis I (from threonine): ILEUSYN-PWY
- 7 reactions found over 7 reactions in the full pathway
- PWY-5826, hypoglycin biosynthesis: PWY-5826
- 4 reactions found over 14 reactions in the full pathway
- PWY-5437, L-threonine degradation I: PWY-5437
- 3 reactions found over 6 reactions in the full pathway
- PWY-701, L-methionine degradation II: PWY-701
- 2 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation