Difference between revisions of "CPD-15153"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta17-C36-ACPs cis-delta17-C36-ACPs] == * common name: ** a cis-delta17-C36:1-[acp] * Syn...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1) | ||
* common name: | * common name: | ||
− | ** | + | ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone |
+ | * inchi key: | ||
+ | ** InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N | ||
+ | * molecular weight: | ||
+ | ** 697.095 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14177]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05814 C05814] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28636 28636] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280836 5280836] | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)}} | ||
+ | {{#set: common name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}} | ||
+ | {{#set: inchi key=InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N}} | ||
+ | {{#set: molecular weight=697.095 }} | ||
+ | {{#set: produced by=RXN-14177}} |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite CPD-15153
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)
- common name:
- 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
- inchi key:
- InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N
- molecular weight:
- 697.095
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links